C20H36O3 — CID 11324798
(3R)-2-(4,4-dimethoxybutyl)-3-[(E)-oct-1-enyl]cyclohexan-1-one (PubChem CID 11324798) has the molecular formula C20H36O3 and a molecular weight of 324.51 g/mol. Its IUPAC name is (3R)-2-(4,4-dimethoxybutyl)-3-[(E)-oct-1-enyl]cyclohexan-1-one.
| Compound Name | (3R)-2-(4,4-dimethoxybutyl)-3-[(E)-oct-1-enyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 11324798 |
| Molecular Formula | C20H36O3 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.27 |
| IUPAC Name | (3R)-2-(4,4-dimethoxybutyl)-3-[(E)-oct-1-enyl]cyclohexan-1-one |
| SMILES | CCCCCC/C=C/[C@H]1CCCC(=O)C1CCCC(OC)OC |
| InChI | InChI=1S/C20H36O3/c1-4-5-6-7-8-9-12-17-13-10-15-19(21)18(17)14-11-16-20(22-2)23-3/h9,12,17-18,20H,4-8,10-11,13-16H2,1-3H3/b12-9+/t17-,18?/m0/s1 |
| InChIKey | QHKPYXBLNOOGBM-IOVSNWOCSA-N |
| XLogP | 5.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|