About (3R)-2-(4,4-dimethoxybutyl)-3-[(E)-oct-1-enyl]cyclohexan-1-one
(3R)-2-(4,4-dimethoxybutyl)-3-[(E)-oct-1-enyl]cyclohexan-1-one (PubChem CID 11324798) has the molecular formula C20H36O3
and a molecular weight of 324.51 g/mol. Its IUPAC name is (3R)-2-(4,4-dimethoxybutyl)-3-[(E)-oct-1-enyl]cyclohexan-1-one.
Molecular Properties
| Compound Name | (3R)-2-(4,4-dimethoxybutyl)-3-[(E)-oct-1-enyl]cyclohexan-1-one |
| PubChem CID | 11324798 |
| Molecular Formula | C20H36O3 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.27 |
| IUPAC Name | (3R)-2-(4,4-dimethoxybutyl)-3-[(E)-oct-1-enyl]cyclohexan-1-one |
| SMILES | CCCCCC/C=C/[C@H]1CCCC(=O)C1CCCC(OC)OC |
| InChI | InChI=1S/C20H36O3/c1-4-5-6-7-8-9-12-17-13-10-15-19(21)18(17)14-11-16-20(22-2)23-3/h9,12,17-18,20H,4-8,10-11,13-16H2,1-3H3/b12-9+/t17-,18?/m0/s1 |
| InChIKey | QHKPYXBLNOOGBM-IOVSNWOCSA-N |
| XLogP | 5.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3R)-2-(4,4-dimethoxybutyl)-3-[(E)-oct-1-enyl]cyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-2-(4,4-dimethoxybutyl)-3-[(E)-oct-1-enyl]cyclohexan-1-one?
The IUPAC name of (3R)-2-(4,4-dimethoxybutyl)-3-[(E)-oct-1-enyl]cyclohexan-1-one (CID 11324798) is (3R)-2-(4,4-dimethoxybutyl)-3-[(E)-oct-1-enyl]cyclohexan-1-one.
What is the SMILES notation for (3R)-2-(4,4-dimethoxybutyl)-3-[(E)-oct-1-enyl]cyclohexan-1-one?
The canonical SMILES for (3R)-2-(4,4-dimethoxybutyl)-3-[(E)-oct-1-enyl]cyclohexan-1-one is CCCCCC/C=C/[C@H]1CCCC(=O)C1CCCC(OC)OC.
What is the InChIKey of (3R)-2-(4,4-dimethoxybutyl)-3-[(E)-oct-1-enyl]cyclohexan-1-one?
The InChIKey is QHKPYXBLNOOGBM-IOVSNWOCSA-N. The full InChI is InChI=1S/C20H36O3/c1-4-5-6-7-8-9-12-17-13-10-15-19(21)18(17)14-11-16-20(22-2)23-3/h9,12,17-18,20H,4-8,10-11,13-16H2,1-3H3/b12-9+/t17-,18?/m0/s1.
What are the key properties of (3R)-2-(4,4-dimethoxybutyl)-3-[(E)-oct-1-enyl]cyclohexan-1-one?
(3R)-2-(4,4-dimethoxybutyl)-3-[(E)-oct-1-enyl]cyclohexan-1-one has a molecular weight of 324.51 g/mol, XLogP of 5.29, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-2-(4,4-dimethoxybutyl)-3-[(E)-oct-1-enyl]cyclohexan-1-one is sourced from PubChem (CID 11324798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).