C13H16N2O2S — CID 113248044
4-(cyanomethyl)-N-ethyl-N-prop-2-enylbenzenesulfonamide (PubChem CID 113248044) has the molecular formula C13H16N2O2S and a molecular weight of 264.35 g/mol. Its IUPAC name is 4-(cyanomethyl)-N-ethyl-N-prop-2-enylbenzenesulfonamide.
| Compound Name | 4-(cyanomethyl)-N-ethyl-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 113248044 |
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 4-(cyanomethyl)-N-ethyl-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCN(CC)S(=O)(=O)c1ccc(CC#N)cc1 |
| InChI | InChI=1S/C13H16N2O2S/c1-3-11-15(4-2)18(16,17)13-7-5-12(6-8-13)9-10-14/h3,5-8H,1,4,9,11H2,2H3 |
| InChIKey | KTORLCFDCZQKFU-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|