C12H16ClNO3S — CID 113248423
5-chloro-2-hydroxy-N-(4-methylsulfinylbutan-2-yl)benzamide (PubChem CID 113248423) has the molecular formula C12H16ClNO3S and a molecular weight of 289.78 g/mol. Its IUPAC name is 5-chloro-2-hydroxy-N-(4-methylsulfinylbutan-2-yl)benzamide.
| Compound Name | 5-chloro-2-hydroxy-N-(4-methylsulfinylbutan-2-yl)benzamide |
|---|---|
| PubChem CID | 113248423 |
| Molecular Formula | C12H16ClNO3S |
| Molecular Weight | 289.78 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 5-chloro-2-hydroxy-N-(4-methylsulfinylbutan-2-yl)benzamide |
| SMILES | CC(CCS(C)=O)NC(=O)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C12H16ClNO3S/c1-8(5-6-18(2)17)14-12(16)10-7-9(13)3-4-11(10)15/h3-4,7-8,15H,5-6H2,1-2H3,(H,14,16) |
| InChIKey | XNNYYHTWCOKRGJ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.78 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |