C12H22F3NO2 — CID 113249095
3,5,5-trimethyl-N-(3,3,3-trifluoro-2-hydroxypropyl)hexanamide (PubChem CID 113249095) has the molecular formula C12H22F3NO2 and a molecular weight of 269.31 g/mol. Its IUPAC name is 3,5,5-trimethyl-N-(3,3,3-trifluoro-2-hydroxypropyl)hexanamide.
| Compound Name | 3,5,5-trimethyl-N-(3,3,3-trifluoro-2-hydroxypropyl)hexanamide |
|---|---|
| PubChem CID | 113249095 |
| Molecular Formula | C12H22F3NO2 |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 3,5,5-trimethyl-N-(3,3,3-trifluoro-2-hydroxypropyl)hexanamide |
| SMILES | CC(CC(=O)NCC(O)C(F)(F)F)CC(C)(C)C |
| InChI | InChI=1S/C12H22F3NO2/c1-8(6-11(2,3)4)5-10(18)16-7-9(17)12(13,14)15/h8-9,17H,5-7H2,1-4H3,(H,16,18) |
| InChIKey | KOKOHMDLWRAOKI-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |