C8H13F3N2O3S — CID 113249098
3-(2-amino-2-oxoethyl)sulfanyl-N-(3,3,3-trifluoro-2-hydroxypropyl)propanamide (PubChem CID 113249098) has the molecular formula C8H13F3N2O3S and a molecular weight of 274.26 g/mol. Its IUPAC name is 3-(2-amino-2-oxoethyl)sulfanyl-N-(3,3,3-trifluoro-2-hydroxypropyl)propanamide.
| Compound Name | 3-(2-amino-2-oxoethyl)sulfanyl-N-(3,3,3-trifluoro-2-hydroxypropyl)propanamide |
|---|---|
| PubChem CID | 113249098 |
| Molecular Formula | C8H13F3N2O3S |
| Molecular Weight | 274.26 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 3-(2-amino-2-oxoethyl)sulfanyl-N-(3,3,3-trifluoro-2-hydroxypropyl)propanamide |
| SMILES | NC(=O)CSCCC(=O)NCC(O)C(F)(F)F |
| InChI | InChI=1S/C8H13F3N2O3S/c9-8(10,11)5(14)3-13-7(16)1-2-17-4-6(12)15/h5,14H,1-4H2,(H2,12,15)(H,13,16) |
| InChIKey | CIOPNTYXDGHJBN-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.26 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|