C12H17BrN2O2S2 — CID 113249327
5-bromo-N-(2-ethylsulfanylcyclopentyl)pyridine-3-sulfonamide (PubChem CID 113249327) has the molecular formula C12H17BrN2O2S2 and a molecular weight of 365.32 g/mol. Its IUPAC name is 5-bromo-N-(2-ethylsulfanylcyclopentyl)pyridine-3-sulfonamide.
| Compound Name | 5-bromo-N-(2-ethylsulfanylcyclopentyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 113249327 |
| Molecular Formula | C12H17BrN2O2S2 |
| Molecular Weight | 365.32 g/mol |
| Exact Mass | 363.99 |
| IUPAC Name | 5-bromo-N-(2-ethylsulfanylcyclopentyl)pyridine-3-sulfonamide |
| SMILES | CCSC1CCCC1NS(=O)(=O)c1cncc(Br)c1 |
| InChI | InChI=1S/C12H17BrN2O2S2/c1-2-18-12-5-3-4-11(12)15-19(16,17)10-6-9(13)7-14-8-10/h6-8,11-12,15H,2-5H2,1H3 |
| InChIKey | NRHMTCGZOQSPSI-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |