C18H22N2O4 — CID 11324976
2-[(2S)-4-benzyl-3,5-dioxo-1,4-diazaspiro[5.5]undecan-2-yl]acetic acid (PubChem CID 11324976) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 2-[(2S)-4-benzyl-3,5-dioxo-1,4-diazaspiro[5.5]undecan-2-yl]acetic acid.
| Compound Name | 2-[(2S)-4-benzyl-3,5-dioxo-1,4-diazaspiro[5.5]undecan-2-yl]acetic acid |
|---|---|
| PubChem CID | 11324976 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 2-[(2S)-4-benzyl-3,5-dioxo-1,4-diazaspiro[5.5]undecan-2-yl]acetic acid |
| SMILES | O=C(O)C[C@@H]1NC2(CCCCC2)C(=O)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C18H22N2O4/c21-15(22)11-14-16(23)20(12-13-7-3-1-4-8-13)17(24)18(19-14)9-5-2-6-10-18/h1,3-4,7-8,14,19H,2,5-6,9-12H2,(H,21,22)/t14-/m0/s1 |
| InChIKey | RRKVATWAMRKDGW-AWEZNQCLSA-N |
| XLogP | 1.69 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|