C19H17ClN2O2S — CID 1132501
N-[4-(butanoylamino)phenyl]-3-chloro-1-benzothiophene-2-carboxamide (PubChem CID 1132501) has the molecular formula C19H17ClN2O2S and a molecular weight of 372.88 g/mol. Its IUPAC name is N-[4-(butanoylamino)phenyl]-3-chloro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[4-(butanoylamino)phenyl]-3-chloro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 1132501 |
| Molecular Formula | C19H17ClN2O2S |
| Molecular Weight | 372.88 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | N-[4-(butanoylamino)phenyl]-3-chloro-1-benzothiophene-2-carboxamide |
| SMILES | CCCC(=O)Nc1ccc(NC(=O)c2sc3ccccc3c2Cl)cc1 |
| InChI | InChI=1S/C19H17ClN2O2S/c1-2-5-16(23)21-12-8-10-13(11-9-12)22-19(24)18-17(20)14-6-3-4-7-15(14)25-18/h3-4,6-11H,2,5H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | GLGZBZPOKQEEEM-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.88 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |