About (3E)-5-(4-chlorophenyl)-3-[(4-chlorophenyl)methylidene]-2,2-dimethyloxolane
(3E)-5-(4-chlorophenyl)-3-[(4-chlorophenyl)methylidene]-2,2-dimethyloxolane (PubChem CID 11325065) has the molecular formula C19H18Cl2O
and a molecular weight of 333.26 g/mol. Its IUPAC name is (3E)-5-(4-chlorophenyl)-3-[(4-chlorophenyl)methylidene]-2,2-dimethyloxolane.
Molecular Properties
| Compound Name | (3E)-5-(4-chlorophenyl)-3-[(4-chlorophenyl)methylidene]-2,2-dimethyloxolane |
| PubChem CID | 11325065 |
| Molecular Formula | C19H18Cl2O |
| Molecular Weight | 333.26 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | (3E)-5-(4-chlorophenyl)-3-[(4-chlorophenyl)methylidene]-2,2-dimethyloxolane |
| SMILES | CC1(C)OC(c2ccc(Cl)cc2)C/C1=C\c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H18Cl2O/c1-19(2)15(11-13-3-7-16(20)8-4-13)12-18(22-19)14-5-9-17(21)10-6-14/h3-11,18H,12H2,1-2H3/b15-11+ |
| InChIKey | DBKDWWCHBKGSLS-RVDMUPIBSA-N |
| XLogP | 6.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 333.26 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3E)-5-(4-chlorophenyl)-3-[(4-chlorophenyl)methylidene]-2,2-dimethyloxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-5-(4-chlorophenyl)-3-[(4-chlorophenyl)methylidene]-2,2-dimethyloxolane?
The IUPAC name of (3E)-5-(4-chlorophenyl)-3-[(4-chlorophenyl)methylidene]-2,2-dimethyloxolane (CID 11325065) is (3E)-5-(4-chlorophenyl)-3-[(4-chlorophenyl)methylidene]-2,2-dimethyloxolane.
What is the SMILES notation for (3E)-5-(4-chlorophenyl)-3-[(4-chlorophenyl)methylidene]-2,2-dimethyloxolane?
The canonical SMILES for (3E)-5-(4-chlorophenyl)-3-[(4-chlorophenyl)methylidene]-2,2-dimethyloxolane is CC1(C)OC(c2ccc(Cl)cc2)C/C1=C\c1ccc(Cl)cc1.
What is the InChIKey of (3E)-5-(4-chlorophenyl)-3-[(4-chlorophenyl)methylidene]-2,2-dimethyloxolane?
The InChIKey is DBKDWWCHBKGSLS-RVDMUPIBSA-N. The full InChI is InChI=1S/C19H18Cl2O/c1-19(2)15(11-13-3-7-16(20)8-4-13)12-18(22-19)14-5-9-17(21)10-6-14/h3-11,18H,12H2,1-2H3/b15-11+.
What are the key properties of (3E)-5-(4-chlorophenyl)-3-[(4-chlorophenyl)methylidene]-2,2-dimethyloxolane?
(3E)-5-(4-chlorophenyl)-3-[(4-chlorophenyl)methylidene]-2,2-dimethyloxolane has a molecular weight of 333.26 g/mol, XLogP of 6.32, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-5-(4-chlorophenyl)-3-[(4-chlorophenyl)methylidene]-2,2-dimethyloxolane is sourced from PubChem (CID 11325065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).