C12H11F2N3O — CID 113251945
N-(4-ethyl-1H-pyrazol-5-yl)-3,4-difluorobenzamide (PubChem CID 113251945) has the molecular formula C12H11F2N3O and a molecular weight of 251.24 g/mol. Its IUPAC name is N-(4-ethyl-1H-pyrazol-5-yl)-3,4-difluorobenzamide.
| Compound Name | N-(4-ethyl-1H-pyrazol-5-yl)-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 113251945 |
| Molecular Formula | C12H11F2N3O |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | N-(4-ethyl-1H-pyrazol-5-yl)-3,4-difluorobenzamide |
| SMILES | CCc1cn[nH]c1NC(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H11F2N3O/c1-2-7-6-15-17-11(7)16-12(18)8-3-4-9(13)10(14)5-8/h3-6H,2H2,1H3,(H2,15,16,17,18) |
| InChIKey | ORGQRVKQFPOPJP-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |