C11H17F3N4 — CID 113252272
N-[(3-methyltriazol-4-yl)methyl]-4-(trifluoromethyl)cyclohexan-1-amine (PubChem CID 113252272) has the molecular formula C11H17F3N4 and a molecular weight of 262.28 g/mol. Its IUPAC name is N-[(3-methyltriazol-4-yl)methyl]-4-(trifluoromethyl)cyclohexan-1-amine.
| Compound Name | N-[(3-methyltriazol-4-yl)methyl]-4-(trifluoromethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 113252272 |
| Molecular Formula | C11H17F3N4 |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | N-[(3-methyltriazol-4-yl)methyl]-4-(trifluoromethyl)cyclohexan-1-amine |
| SMILES | Cn1nncc1CNC1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H17F3N4/c1-18-10(7-16-17-18)6-15-9-4-2-8(3-5-9)11(12,13)14/h7-9,15H,2-6H2,1H3 |
| InChIKey | FOLJCKBVTJPCNN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |