C21H27NO3 — CID 11325308
benzyl (5R,6S)-6-ethyl-7-oxo-5-propyl-2,3,5,6-tetrahydro-1H-indolizine-8-carboxylate (PubChem CID 11325308) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is benzyl (5R,6S)-6-ethyl-7-oxo-5-propyl-2,3,5,6-tetrahydro-1H-indolizine-8-carboxylate.
| Compound Name | benzyl (5R,6S)-6-ethyl-7-oxo-5-propyl-2,3,5,6-tetrahydro-1H-indolizine-8-carboxylate |
|---|---|
| PubChem CID | 11325308 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | benzyl (5R,6S)-6-ethyl-7-oxo-5-propyl-2,3,5,6-tetrahydro-1H-indolizine-8-carboxylate |
| SMILES | CCC[C@@H]1[C@H](CC)C(=O)C(C(=O)OCc2ccccc2)=C2CCCN21 |
| InChI | InChI=1S/C21H27NO3/c1-3-9-17-16(4-2)20(23)19(18-12-8-13-22(17)18)21(24)25-14-15-10-6-5-7-11-15/h5-7,10-11,16-17H,3-4,8-9,12-14H2,1-2H3/t16-,17+/m0/s1 |
| InChIKey | YWLIUVOGFHIWAN-DLBZAZTESA-N |
| XLogP | 3.86 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|