C8H10F4N4O — CID 113253852
2,2,3,3-tetrafluoro-N-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]propanamide (PubChem CID 113253852) has the molecular formula C8H10F4N4O and a molecular weight of 254.19 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]propanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 113253852 |
| Molecular Formula | C8H10F4N4O |
| Molecular Weight | 254.19 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]propanamide |
| SMILES | Cn1cnc(CCNC(=O)C(F)(F)C(F)F)n1 |
| InChI | InChI=1S/C8H10F4N4O/c1-16-4-14-5(15-16)2-3-13-7(17)8(11,12)6(9)10/h4,6H,2-3H2,1H3,(H,13,17) |
| InChIKey | IMZLPSYDWVAESL-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.19 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|