C19H40O3Si — CID 11325396
(3S,4R,7S)-3-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-4-methyldodecan-5-one (PubChem CID 11325396) has the molecular formula C19H40O3Si and a molecular weight of 344.61 g/mol. Its IUPAC name is (3S,4R,7S)-3-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-4-methyldodecan-5-one.
| Compound Name | (3S,4R,7S)-3-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-4-methyldodecan-5-one |
|---|---|
| PubChem CID | 11325396 |
| Molecular Formula | C19H40O3Si |
| Molecular Weight | 344.61 g/mol |
| Exact Mass | 344.27 |
| IUPAC Name | (3S,4R,7S)-3-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-4-methyldodecan-5-one |
| SMILES | CCCCC[C@H](O)CC(=O)[C@H](C)[C@H](CC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H40O3Si/c1-9-11-12-13-16(20)14-17(21)15(3)18(10-2)22-23(7,8)19(4,5)6/h15-16,18,20H,9-14H2,1-8H3/t15-,16-,18-/m0/s1 |
| InChIKey | MHJCJQQLFCIGQF-BQFCYCMXSA-N |
| XLogP | 5.32 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.61 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|