About N-[2,3-dimethoxy-5-[(E)-2-naphthalen-2-ylethenyl]phenyl]acetamide
N-[2,3-dimethoxy-5-[(E)-2-naphthalen-2-ylethenyl]phenyl]acetamide (PubChem CID 11325470) has the molecular formula C22H21NO3
and a molecular weight of 347.41 g/mol. Its IUPAC name is N-[2,3-dimethoxy-5-[(E)-2-naphthalen-2-ylethenyl]phenyl]acetamide.
Molecular Properties
| Compound Name | N-[2,3-dimethoxy-5-[(E)-2-naphthalen-2-ylethenyl]phenyl]acetamide |
| PubChem CID | 11325470 |
| Molecular Formula | C22H21NO3 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | N-[2,3-dimethoxy-5-[(E)-2-naphthalen-2-ylethenyl]phenyl]acetamide |
| SMILES | COc1cc(/C=C/c2ccc3ccccc3c2)cc(NC(C)=O)c1OC |
| InChI | InChI=1S/C22H21NO3/c1-15(24)23-20-13-17(14-21(25-2)22(20)26-3)9-8-16-10-11-18-6-4-5-7-19(18)12-16/h4-14H,1-3H3,(H,23,24)/b9-8+ |
| InChIKey | FTFGEZDIWLCNNA-CMDGGOBGSA-N |
| XLogP | 4.99 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze N-[2,3-dimethoxy-5-[(E)-2-naphthalen-2-ylethenyl]phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2,3-dimethoxy-5-[(E)-2-naphthalen-2-ylethenyl]phenyl]acetamide?
The IUPAC name of N-[2,3-dimethoxy-5-[(E)-2-naphthalen-2-ylethenyl]phenyl]acetamide (CID 11325470) is N-[2,3-dimethoxy-5-[(E)-2-naphthalen-2-ylethenyl]phenyl]acetamide.
What is the SMILES notation for N-[2,3-dimethoxy-5-[(E)-2-naphthalen-2-ylethenyl]phenyl]acetamide?
The canonical SMILES for N-[2,3-dimethoxy-5-[(E)-2-naphthalen-2-ylethenyl]phenyl]acetamide is COc1cc(/C=C/c2ccc3ccccc3c2)cc(NC(C)=O)c1OC.
What is the InChIKey of N-[2,3-dimethoxy-5-[(E)-2-naphthalen-2-ylethenyl]phenyl]acetamide?
The InChIKey is FTFGEZDIWLCNNA-CMDGGOBGSA-N. The full InChI is InChI=1S/C22H21NO3/c1-15(24)23-20-13-17(14-21(25-2)22(20)26-3)9-8-16-10-11-18-6-4-5-7-19(18)12-16/h4-14H,1-3H3,(H,23,24)/b9-8+.
What are the key properties of N-[2,3-dimethoxy-5-[(E)-2-naphthalen-2-ylethenyl]phenyl]acetamide?
N-[2,3-dimethoxy-5-[(E)-2-naphthalen-2-ylethenyl]phenyl]acetamide has a molecular weight of 347.41 g/mol, XLogP of 4.99, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2,3-dimethoxy-5-[(E)-2-naphthalen-2-ylethenyl]phenyl]acetamide is sourced from PubChem (CID 11325470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).