About N-[(3E)-hexa-3,5-dienyl]-4-methyl-N-(2-trimethylsilylethynyl)benzenesulfonamide
N-[(3E)-hexa-3,5-dienyl]-4-methyl-N-(2-trimethylsilylethynyl)benzenesulfonamide (PubChem CID 11325479) has the molecular formula C18H25NO2SSi
and a molecular weight of 347.56 g/mol. Its IUPAC name is N-[(3E)-hexa-3,5-dienyl]-4-methyl-N-(2-trimethylsilylethynyl)benzenesulfonamide.
Molecular Properties
| Compound Name | N-[(3E)-hexa-3,5-dienyl]-4-methyl-N-(2-trimethylsilylethynyl)benzenesulfonamide |
| PubChem CID | 11325479 |
| Molecular Formula | C18H25NO2SSi |
| Molecular Weight | 347.56 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | N-[(3E)-hexa-3,5-dienyl]-4-methyl-N-(2-trimethylsilylethynyl)benzenesulfonamide |
| SMILES | C=C/C=C/CCN(C#C[Si](C)(C)C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H25NO2SSi/c1-6-7-8-9-14-19(15-16-23(3,4)5)22(20,21)18-12-10-17(2)11-13-18/h6-8,10-13H,1,9,14H2,2-5H3/b8-7+ |
| InChIKey | LOPLELHKKVDKFJ-BQYQJAHWSA-N |
| XLogP | 3.96 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.56 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(3E)-hexa-3,5-dienyl]-4-methyl-N-(2-trimethylsilylethynyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3E)-hexa-3,5-dienyl]-4-methyl-N-(2-trimethylsilylethynyl)benzenesulfonamide?
The IUPAC name of N-[(3E)-hexa-3,5-dienyl]-4-methyl-N-(2-trimethylsilylethynyl)benzenesulfonamide (CID 11325479) is N-[(3E)-hexa-3,5-dienyl]-4-methyl-N-(2-trimethylsilylethynyl)benzenesulfonamide.
What is the SMILES notation for N-[(3E)-hexa-3,5-dienyl]-4-methyl-N-(2-trimethylsilylethynyl)benzenesulfonamide?
The canonical SMILES for N-[(3E)-hexa-3,5-dienyl]-4-methyl-N-(2-trimethylsilylethynyl)benzenesulfonamide is C=C/C=C/CCN(C#C[Si](C)(C)C)S(=O)(=O)c1ccc(C)cc1.
What is the InChIKey of N-[(3E)-hexa-3,5-dienyl]-4-methyl-N-(2-trimethylsilylethynyl)benzenesulfonamide?
The InChIKey is LOPLELHKKVDKFJ-BQYQJAHWSA-N. The full InChI is InChI=1S/C18H25NO2SSi/c1-6-7-8-9-14-19(15-16-23(3,4)5)22(20,21)18-12-10-17(2)11-13-18/h6-8,10-13H,1,9,14H2,2-5H3/b8-7+.
What are the key properties of N-[(3E)-hexa-3,5-dienyl]-4-methyl-N-(2-trimethylsilylethynyl)benzenesulfonamide?
N-[(3E)-hexa-3,5-dienyl]-4-methyl-N-(2-trimethylsilylethynyl)benzenesulfonamide has a molecular weight of 347.56 g/mol, XLogP of 3.96, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3E)-hexa-3,5-dienyl]-4-methyl-N-(2-trimethylsilylethynyl)benzenesulfonamide is sourced from PubChem (CID 11325479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).