C14H21BrN2O — CID 113255136
2-bromo-N-(2,4,4-trimethylpentan-2-yl)pyridine-3-carboxamide (PubChem CID 113255136) has the molecular formula C14H21BrN2O and a molecular weight of 313.24 g/mol. Its IUPAC name is 2-bromo-N-(2,4,4-trimethylpentan-2-yl)pyridine-3-carboxamide.
| Compound Name | 2-bromo-N-(2,4,4-trimethylpentan-2-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 113255136 |
| Molecular Formula | C14H21BrN2O |
| Molecular Weight | 313.24 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 2-bromo-N-(2,4,4-trimethylpentan-2-yl)pyridine-3-carboxamide |
| SMILES | CC(C)(C)CC(C)(C)NC(=O)c1cccnc1Br |
| InChI | InChI=1S/C14H21BrN2O/c1-13(2,3)9-14(4,5)17-12(18)10-7-6-8-16-11(10)15/h6-8H,9H2,1-5H3,(H,17,18) |
| InChIKey | PDUSHYBAAUJEPS-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.24 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|