C13H24N2O2 — CID 113255358
N-(2,2-dimethylcyclohexyl)morpholine-4-carboxamide (PubChem CID 113255358) has the molecular formula C13H24N2O2 and a molecular weight of 240.35 g/mol. Its IUPAC name is N-(2,2-dimethylcyclohexyl)morpholine-4-carboxamide.
| Compound Name | N-(2,2-dimethylcyclohexyl)morpholine-4-carboxamide |
|---|---|
| PubChem CID | 113255358 |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | N-(2,2-dimethylcyclohexyl)morpholine-4-carboxamide |
| SMILES | CC1(C)CCCCC1NC(=O)N1CCOCC1 |
| InChI | InChI=1S/C13H24N2O2/c1-13(2)6-4-3-5-11(13)14-12(16)15-7-9-17-10-8-15/h11H,3-10H2,1-2H3,(H,14,16) |
| InChIKey | ILASTSKFBINHKG-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |