C21H38O2Si — CID 11325581
3-[(3R,5R)-2-methylidene-5-(2-methylpropyl)oxolan-3-yl]oxyprop-1-ynyl-tri(propan-2-yl)silane (PubChem CID 11325581) has the molecular formula C21H38O2Si and a molecular weight of 350.62 g/mol. Its IUPAC name is 3-[(3R,5R)-2-methylidene-5-(2-methylpropyl)oxolan-3-yl]oxyprop-1-ynyl-tri(propan-2-yl)silane.
| Compound Name | 3-[(3R,5R)-2-methylidene-5-(2-methylpropyl)oxolan-3-yl]oxyprop-1-ynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 11325581 |
| Molecular Formula | C21H38O2Si |
| Molecular Weight | 350.62 g/mol |
| Exact Mass | 350.26 |
| IUPAC Name | 3-[(3R,5R)-2-methylidene-5-(2-methylpropyl)oxolan-3-yl]oxyprop-1-ynyl-tri(propan-2-yl)silane |
| SMILES | C=C1O[C@H](CC(C)C)C[C@H]1OCC#C[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C21H38O2Si/c1-15(2)13-20-14-21(19(9)23-20)22-11-10-12-24(16(3)4,17(5)6)18(7)8/h15-18,20-21H,9,11,13-14H2,1-8H3/t20-,21-/m1/s1 |
| InChIKey | XSYXIVSBKCKUAZ-NHCUHLMSSA-N |
| XLogP | 5.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.62 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|