C21H24N2O3 — CID 11325633
(4S,5R)-1-[(5S)-5-[2-(furan-2-yl)ethyl]-2,5-dihydrofuran-2-yl]-3,4-dimethyl-5-phenylimidazolidin-2-one (PubChem CID 11325633) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is (4S,5R)-1-[(5S)-5-[2-(furan-2-yl)ethyl]-2,5-dihydrofuran-2-yl]-3,4-dimethyl-5-phenylimidazolidin-2-one.
| Compound Name | (4S,5R)-1-[(5S)-5-[2-(furan-2-yl)ethyl]-2,5-dihydrofuran-2-yl]-3,4-dimethyl-5-phenylimidazolidin-2-one |
|---|---|
| PubChem CID | 11325633 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | (4S,5R)-1-[(5S)-5-[2-(furan-2-yl)ethyl]-2,5-dihydrofuran-2-yl]-3,4-dimethyl-5-phenylimidazolidin-2-one |
| SMILES | C[C@H]1[C@@H](c2ccccc2)N(C2C=C[C@H](CCc3ccco3)O2)C(=O)N1C |
| InChI | InChI=1S/C21H24N2O3/c1-15-20(16-7-4-3-5-8-16)23(21(24)22(15)2)19-13-12-18(26-19)11-10-17-9-6-14-25-17/h3-9,12-15,18-20H,10-11H2,1-2H3/t15-,18-,19?,20-/m0/s1 |
| InChIKey | VPPQHYFMYAGVRD-GZKUECPQSA-N |
| XLogP | 3.99 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|