C11H10N4O2 — CID 113257427
3-nitro-2-(pent-4-ynylamino)pyridine-4-carbonitrile (PubChem CID 113257427) has the molecular formula C11H10N4O2 and a molecular weight of 230.23 g/mol. Its IUPAC name is 3-nitro-2-(pent-4-ynylamino)pyridine-4-carbonitrile.
| Compound Name | 3-nitro-2-(pent-4-ynylamino)pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 113257427 |
| Molecular Formula | C11H10N4O2 |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 3-nitro-2-(pent-4-ynylamino)pyridine-4-carbonitrile |
| SMILES | C#CCCCNc1nccc(C#N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H10N4O2/c1-2-3-4-6-13-11-10(15(16)17)9(8-12)5-7-14-11/h1,5,7H,3-4,6H2,(H,13,14) |
| InChIKey | LMLRVOQXLDDYPA-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|