C11H11F4NO2 — CID 113257758
2,2,3,3-tetrafluoro-N-[(4-hydroxyphenyl)methyl]-N-methylpropanamide (PubChem CID 113257758) has the molecular formula C11H11F4NO2 and a molecular weight of 265.21 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-[(4-hydroxyphenyl)methyl]-N-methylpropanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N-[(4-hydroxyphenyl)methyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 113257758 |
| Molecular Formula | C11H11F4NO2 |
| Molecular Weight | 265.21 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-[(4-hydroxyphenyl)methyl]-N-methylpropanamide |
| SMILES | CN(Cc1ccc(O)cc1)C(=O)C(F)(F)C(F)F |
| InChI | InChI=1S/C11H11F4NO2/c1-16(10(18)11(14,15)9(12)13)6-7-2-4-8(17)5-3-7/h2-5,9,17H,6H2,1H3 |
| InChIKey | TWGSPFJNNLQYNO-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.21 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|