C21H28O5 — CID 11325867
[(4S,4aR,5R,6S,9aS)-4-methoxy-3,4a,5-trimethyl-2-oxo-4,5,6,7,8,9a-hexahydrobenzo[f][1]benzofuran-6-yl] (Z)-2-methylbut-2-enoate (PubChem CID 11325867) has the molecular formula C21H28O5 and a molecular weight of 360.45 g/mol. Its IUPAC name is [(4S,4aR,5R,6S,9aS)-4-methoxy-3,4a,5-trimethyl-2-oxo-4,5,6,7,8,9a-hexahydrobenzo[f][1]benzofuran-6-yl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(4S,4aR,5R,6S,9aS)-4-methoxy-3,4a,5-trimethyl-2-oxo-4,5,6,7,8,9a-hexahydrobenzo[f][1]benzofuran-6-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 11325867 |
| Molecular Formula | C21H28O5 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | [(4S,4aR,5R,6S,9aS)-4-methoxy-3,4a,5-trimethyl-2-oxo-4,5,6,7,8,9a-hexahydrobenzo[f][1]benzofuran-6-yl] (Z)-2-methylbut-2-enoate |
| SMILES | C/C=C(/C)C(=O)O[C@H]1CCC2=C[C@@H]3OC(=O)C(C)=C3[C@@H](OC)[C@]2(C)[C@H]1C |
| InChI | InChI=1S/C21H28O5/c1-7-11(2)19(22)25-15-9-8-14-10-16-17(12(3)20(23)26-16)18(24-6)21(14,5)13(15)4/h7,10,13,15-16,18H,8-9H2,1-6H3/b11-7-/t13-,15-,16-,18+,21+/m0/s1 |
| InChIKey | WKZIMJTUNFMKDY-QUPJYPITSA-N |
| XLogP | 3.50 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|