C14H17BrClNO2 — CID 113259178
(4-bromo-3-chlorophenyl)-[3-(methoxymethyl)piperidin-1-yl]methanone (PubChem CID 113259178) has the molecular formula C14H17BrClNO2 and a molecular weight of 346.65 g/mol. Its IUPAC name is (4-bromo-3-chlorophenyl)-[3-(methoxymethyl)piperidin-1-yl]methanone.
| Compound Name | (4-bromo-3-chlorophenyl)-[3-(methoxymethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 113259178 |
| Molecular Formula | C14H17BrClNO2 |
| Molecular Weight | 346.65 g/mol |
| Exact Mass | 345.01 |
| IUPAC Name | (4-bromo-3-chlorophenyl)-[3-(methoxymethyl)piperidin-1-yl]methanone |
| SMILES | COCC1CCCN(C(=O)c2ccc(Br)c(Cl)c2)C1 |
| InChI | InChI=1S/C14H17BrClNO2/c1-19-9-10-3-2-6-17(8-10)14(18)11-4-5-12(15)13(16)7-11/h4-5,7,10H,2-3,6,8-9H2,1H3 |
| InChIKey | HMWMZQCDLKSBPA-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.65 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |