C18H20F3N5 — CID 11325966
4-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-6-[3-(trifluoromethyl)phenyl]pyrimidin-2-amine (PubChem CID 11325966) has the molecular formula C18H20F3N5 and a molecular weight of 363.39 g/mol. Its IUPAC name is 4-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-6-[3-(trifluoromethyl)phenyl]pyrimidin-2-amine.
| Compound Name | 4-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-6-[3-(trifluoromethyl)phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 11325966 |
| Molecular Formula | C18H20F3N5 |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 4-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-6-[3-(trifluoromethyl)phenyl]pyrimidin-2-amine |
| SMILES | Nc1nc(-c2cccc(C(F)(F)F)c2)cc(N2CC3CCCNC3C2)n1 |
| InChI | InChI=1S/C18H20F3N5/c19-18(20,21)13-5-1-3-11(7-13)14-8-16(25-17(22)24-14)26-9-12-4-2-6-23-15(12)10-26/h1,3,5,7-8,12,15,23H,2,4,6,9-10H2,(H2,22,24,25) |
| InChIKey | DAEZWFZNCMOXIC-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |