C13H17Cl2NO — CID 113259759
1-(2,3-dichlorophenyl)-N-(oxolan-2-ylmethyl)ethanamine (PubChem CID 113259759) has the molecular formula C13H17Cl2NO and a molecular weight of 274.19 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-N-(oxolan-2-ylmethyl)ethanamine.
| Compound Name | 1-(2,3-dichlorophenyl)-N-(oxolan-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 113259759 |
| Molecular Formula | C13H17Cl2NO |
| Molecular Weight | 274.19 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-N-(oxolan-2-ylmethyl)ethanamine |
| SMILES | CC(NCC1CCCO1)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C13H17Cl2NO/c1-9(16-8-10-4-3-7-17-10)11-5-2-6-12(14)13(11)15/h2,5-6,9-10,16H,3-4,7-8H2,1H3 |
| InChIKey | ZGGUWIGGUDYCEC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.19 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |