C14H19IN2O — CID 113259819
N-[2-[1-(4-iodophenyl)ethylamino]ethyl]cyclopropanecarboxamide (PubChem CID 113259819) has the molecular formula C14H19IN2O and a molecular weight of 358.22 g/mol. Its IUPAC name is N-[2-[1-(4-iodophenyl)ethylamino]ethyl]cyclopropanecarboxamide.
| Compound Name | N-[2-[1-(4-iodophenyl)ethylamino]ethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 113259819 |
| Molecular Formula | C14H19IN2O |
| Molecular Weight | 358.22 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | N-[2-[1-(4-iodophenyl)ethylamino]ethyl]cyclopropanecarboxamide |
| SMILES | CC(NCCNC(=O)C1CC1)c1ccc(I)cc1 |
| InChI | InChI=1S/C14H19IN2O/c1-10(11-4-6-13(15)7-5-11)16-8-9-17-14(18)12-2-3-12/h4-7,10,12,16H,2-3,8-9H2,1H3,(H,17,18) |
| InChIKey | BTLIPRGOZSQXEL-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.22 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|