C25H35NO — CID 11326024
(Z,4S)-1-(benzylamino)-2-phenyldodec-2-en-4-ol (PubChem CID 11326024) has the molecular formula C25H35NO and a molecular weight of 365.56 g/mol. Its IUPAC name is (Z,4S)-1-(benzylamino)-2-phenyldodec-2-en-4-ol.
| Compound Name | (Z,4S)-1-(benzylamino)-2-phenyldodec-2-en-4-ol |
|---|---|
| PubChem CID | 11326024 |
| Molecular Formula | C25H35NO |
| Molecular Weight | 365.56 g/mol |
| Exact Mass | 365.27 |
| IUPAC Name | (Z,4S)-1-(benzylamino)-2-phenyldodec-2-en-4-ol |
| SMILES | CCCCCCCC[C@H](O)/C=C(\CNCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H35NO/c1-2-3-4-5-6-13-18-25(27)19-24(23-16-11-8-12-17-23)21-26-20-22-14-9-7-10-15-22/h7-12,14-17,19,25-27H,2-6,13,18,20-21H2,1H3/b24-19+/t25-/m0/s1 |
| InChIKey | VEGGDVALDZRBTP-POQGPQTDSA-N |
| XLogP | 5.97 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.56 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|