C11H20F3NOS — CID 113260356
2,2,5,5-tetramethyl-N-[2-(trifluoromethylsulfanyl)ethyl]oxolan-3-amine (PubChem CID 113260356) has the molecular formula C11H20F3NOS and a molecular weight of 271.35 g/mol. Its IUPAC name is 2,2,5,5-tetramethyl-N-[2-(trifluoromethylsulfanyl)ethyl]oxolan-3-amine.
| Compound Name | 2,2,5,5-tetramethyl-N-[2-(trifluoromethylsulfanyl)ethyl]oxolan-3-amine |
|---|---|
| PubChem CID | 113260356 |
| Molecular Formula | C11H20F3NOS |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 2,2,5,5-tetramethyl-N-[2-(trifluoromethylsulfanyl)ethyl]oxolan-3-amine |
| SMILES | CC1(C)CC(NCCSC(F)(F)F)C(C)(C)O1 |
| InChI | InChI=1S/C11H20F3NOS/c1-9(2)7-8(10(3,4)16-9)15-5-6-17-11(12,13)14/h8,15H,5-7H2,1-4H3 |
| InChIKey | QDVPCUHTZHRQEY-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|