C14H22F3N — CID 113260616
N-(4,4,4-trifluorobutan-2-yl)adamantan-2-amine (PubChem CID 113260616) has the molecular formula C14H22F3N and a molecular weight of 261.33 g/mol. Its IUPAC name is N-(4,4,4-trifluorobutan-2-yl)adamantan-2-amine.
| Compound Name | N-(4,4,4-trifluorobutan-2-yl)adamantan-2-amine |
|---|---|
| PubChem CID | 113260616 |
| Molecular Formula | C14H22F3N |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | N-(4,4,4-trifluorobutan-2-yl)adamantan-2-amine |
| SMILES | CC(CC(F)(F)F)NC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C14H22F3N/c1-8(7-14(15,16)17)18-13-11-3-9-2-10(5-11)6-12(13)4-9/h8-13,18H,2-7H2,1H3 |
| InChIKey | VVMMWMOOCIBEOT-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |