About (2S)-4-[(2R,8R)-8-hydroxy-2-(2-trimethylsilylethoxy)dec-9-ynyl]-2-methyl-2H-furan-5-one
(2S)-4-[(2R,8R)-8-hydroxy-2-(2-trimethylsilylethoxy)dec-9-ynyl]-2-methyl-2H-furan-5-one (PubChem CID 11326063) has the molecular formula C20H34O4Si
and a molecular weight of 366.57 g/mol. Its IUPAC name is (2S)-4-[(2R,8R)-8-hydroxy-2-(2-trimethylsilylethoxy)dec-9-ynyl]-2-methyl-2H-furan-5-one.
Molecular Properties
| Compound Name | (2S)-4-[(2R,8R)-8-hydroxy-2-(2-trimethylsilylethoxy)dec-9-ynyl]-2-methyl-2H-furan-5-one |
| PubChem CID | 11326063 |
| Molecular Formula | C20H34O4Si |
| Molecular Weight | 366.57 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | (2S)-4-[(2R,8R)-8-hydroxy-2-(2-trimethylsilylethoxy)dec-9-ynyl]-2-methyl-2H-furan-5-one |
| SMILES | C#C[C@H](O)CCCCC[C@H](CC1=C[C@H](C)OC1=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C20H34O4Si/c1-6-18(21)10-8-7-9-11-19(23-12-13-25(3,4)5)15-17-14-16(2)24-20(17)22/h1,14,16,18-19,21H,7-13,15H2,2-5H3/t16-,18-,19+/m0/s1 |
| InChIKey | JBLCOBVMLUYURQ-YTQUADARSA-N |
| XLogP | 3.92 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.57 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (2S)-4-[(2R,8R)-8-hydroxy-2-(2-trimethylsilylethoxy)dec-9-ynyl]-2-methyl-2H-furan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-4-[(2R,8R)-8-hydroxy-2-(2-trimethylsilylethoxy)dec-9-ynyl]-2-methyl-2H-furan-5-one?
The IUPAC name of (2S)-4-[(2R,8R)-8-hydroxy-2-(2-trimethylsilylethoxy)dec-9-ynyl]-2-methyl-2H-furan-5-one (CID 11326063) is (2S)-4-[(2R,8R)-8-hydroxy-2-(2-trimethylsilylethoxy)dec-9-ynyl]-2-methyl-2H-furan-5-one.
What is the SMILES notation for (2S)-4-[(2R,8R)-8-hydroxy-2-(2-trimethylsilylethoxy)dec-9-ynyl]-2-methyl-2H-furan-5-one?
The canonical SMILES for (2S)-4-[(2R,8R)-8-hydroxy-2-(2-trimethylsilylethoxy)dec-9-ynyl]-2-methyl-2H-furan-5-one is C#C[C@H](O)CCCCC[C@H](CC1=C[C@H](C)OC1=O)OCC[Si](C)(C)C.
What is the InChIKey of (2S)-4-[(2R,8R)-8-hydroxy-2-(2-trimethylsilylethoxy)dec-9-ynyl]-2-methyl-2H-furan-5-one?
The InChIKey is JBLCOBVMLUYURQ-YTQUADARSA-N. The full InChI is InChI=1S/C20H34O4Si/c1-6-18(21)10-8-7-9-11-19(23-12-13-25(3,4)5)15-17-14-16(2)24-20(17)22/h1,14,16,18-19,21H,7-13,15H2,2-5H3/t16-,18-,19+/m0/s1.
What are the key properties of (2S)-4-[(2R,8R)-8-hydroxy-2-(2-trimethylsilylethoxy)dec-9-ynyl]-2-methyl-2H-furan-5-one?
(2S)-4-[(2R,8R)-8-hydroxy-2-(2-trimethylsilylethoxy)dec-9-ynyl]-2-methyl-2H-furan-5-one has a molecular weight of 366.57 g/mol, XLogP of 3.92, 12 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4-[(2R,8R)-8-hydroxy-2-(2-trimethylsilylethoxy)dec-9-ynyl]-2-methyl-2H-furan-5-one is sourced from PubChem (CID 11326063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).