C20H12F3N3O — CID 11326076
(E)-3-[6-oxo-9-(trifluoromethyl)-7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-3-yl]prop-2-enenitrile (PubChem CID 11326076) has the molecular formula C20H12F3N3O and a molecular weight of 367.33 g/mol. Its IUPAC name is (E)-3-[6-oxo-9-(trifluoromethyl)-7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-3-yl]prop-2-enenitrile.
| Compound Name | (E)-3-[6-oxo-9-(trifluoromethyl)-7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-3-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 11326076 |
| Molecular Formula | C20H12F3N3O |
| Molecular Weight | 367.33 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | (E)-3-[6-oxo-9-(trifluoromethyl)-7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-3-yl]prop-2-enenitrile |
| SMILES | N#C/C=C/c1ccc2c(c1)NC(=O)Cc1c-2[nH]c2ccc(C(F)(F)F)cc12 |
| InChI | InChI=1S/C20H12F3N3O/c21-20(22,23)12-4-6-16-14(9-12)15-10-18(27)25-17-8-11(2-1-7-24)3-5-13(17)19(15)26-16/h1-6,8-9,26H,10H2,(H,25,27)/b2-1+ |
| InChIKey | ZKUCSAVHZKKUJB-OWOJBTEDSA-N |
| XLogP | 4.89 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.33 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|