About 5-fluoro-N-[2-(1,3-thiazol-2-yl)ethyl]-2,3-dihydro-1H-inden-1-amine
5-fluoro-N-[2-(1,3-thiazol-2-yl)ethyl]-2,3-dihydro-1H-inden-1-amine (PubChem CID 113260866) has the molecular formula C14H15FN2S
and a molecular weight of 262.35 g/mol. Its IUPAC name is 5-fluoro-N-[2-(1,3-thiazol-2-yl)ethyl]-2,3-dihydro-1H-inden-1-amine.
Molecular Properties
| Compound Name | 5-fluoro-N-[2-(1,3-thiazol-2-yl)ethyl]-2,3-dihydro-1H-inden-1-amine |
| PubChem CID | 113260866 |
| Molecular Formula | C14H15FN2S |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 5-fluoro-N-[2-(1,3-thiazol-2-yl)ethyl]-2,3-dihydro-1H-inden-1-amine |
| SMILES | Fc1ccc2c(c1)CCC2NCCc1nccs1 |
| InChI | InChI=1S/C14H15FN2S/c15-11-2-3-12-10(9-11)1-4-13(12)16-6-5-14-17-7-8-18-14/h2-3,7-9,13,16H,1,4-6H2 |
| InChIKey | VOSZPACSWLJUDY-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-fluoro-N-[2-(1,3-thiazol-2-yl)ethyl]-2,3-dihydro-1H-inden-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-N-[2-(1,3-thiazol-2-yl)ethyl]-2,3-dihydro-1H-inden-1-amine?
The IUPAC name of 5-fluoro-N-[2-(1,3-thiazol-2-yl)ethyl]-2,3-dihydro-1H-inden-1-amine (CID 113260866) is 5-fluoro-N-[2-(1,3-thiazol-2-yl)ethyl]-2,3-dihydro-1H-inden-1-amine.
What is the SMILES notation for 5-fluoro-N-[2-(1,3-thiazol-2-yl)ethyl]-2,3-dihydro-1H-inden-1-amine?
The canonical SMILES for 5-fluoro-N-[2-(1,3-thiazol-2-yl)ethyl]-2,3-dihydro-1H-inden-1-amine is Fc1ccc2c(c1)CCC2NCCc1nccs1.
What is the InChIKey of 5-fluoro-N-[2-(1,3-thiazol-2-yl)ethyl]-2,3-dihydro-1H-inden-1-amine?
The InChIKey is VOSZPACSWLJUDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15FN2S/c15-11-2-3-12-10(9-11)1-4-13(12)16-6-5-14-17-7-8-18-14/h2-3,7-9,13,16H,1,4-6H2.
What are the key properties of 5-fluoro-N-[2-(1,3-thiazol-2-yl)ethyl]-2,3-dihydro-1H-inden-1-amine?
5-fluoro-N-[2-(1,3-thiazol-2-yl)ethyl]-2,3-dihydro-1H-inden-1-amine has a molecular weight of 262.35 g/mol, XLogP of 3.10, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-N-[2-(1,3-thiazol-2-yl)ethyl]-2,3-dihydro-1H-inden-1-amine is sourced from PubChem (CID 113260866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).