About dimethyl 2-[(1E)-buta-1,3-dienyl]-2-[(E)-4-[tert-butyl(dimethyl)silyl]oxybut-2-enyl]propanedioate
dimethyl 2-[(1E)-buta-1,3-dienyl]-2-[(E)-4-[tert-butyl(dimethyl)silyl]oxybut-2-enyl]propanedioate (PubChem CID 11326122) has the molecular formula C19H32O5Si
and a molecular weight of 368.55 g/mol. Its IUPAC name is dimethyl 2-[(1E)-buta-1,3-dienyl]-2-[(E)-4-[tert-butyl(dimethyl)silyl]oxybut-2-enyl]propanedioate.
Molecular Properties
| Compound Name | dimethyl 2-[(1E)-buta-1,3-dienyl]-2-[(E)-4-[tert-butyl(dimethyl)silyl]oxybut-2-enyl]propanedioate |
| PubChem CID | 11326122 |
| Molecular Formula | C19H32O5Si |
| Molecular Weight | 368.55 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | dimethyl 2-[(1E)-buta-1,3-dienyl]-2-[(E)-4-[tert-butyl(dimethyl)silyl]oxybut-2-enyl]propanedioate |
| SMILES | C=C/C=C/C(C/C=C/CO[Si](C)(C)C(C)(C)C)(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C19H32O5Si/c1-9-10-13-19(16(20)22-5,17(21)23-6)14-11-12-15-24-25(7,8)18(2,3)4/h9-13H,1,14-15H2,2-8H3/b12-11+,13-10+ |
| InChIKey | SSZOHUCYUZLAEP-JASOSIDASA-N |
| XLogP | 4.03 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.55 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 2-[(1E)-buta-1,3-dienyl]-2-[(E)-4-[tert-butyl(dimethyl)silyl]oxybut-2-enyl]propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2-[(1E)-buta-1,3-dienyl]-2-[(E)-4-[tert-butyl(dimethyl)silyl]oxybut-2-enyl]propanedioate?
The IUPAC name of dimethyl 2-[(1E)-buta-1,3-dienyl]-2-[(E)-4-[tert-butyl(dimethyl)silyl]oxybut-2-enyl]propanedioate (CID 11326122) is dimethyl 2-[(1E)-buta-1,3-dienyl]-2-[(E)-4-[tert-butyl(dimethyl)silyl]oxybut-2-enyl]propanedioate.
What is the SMILES notation for dimethyl 2-[(1E)-buta-1,3-dienyl]-2-[(E)-4-[tert-butyl(dimethyl)silyl]oxybut-2-enyl]propanedioate?
The canonical SMILES for dimethyl 2-[(1E)-buta-1,3-dienyl]-2-[(E)-4-[tert-butyl(dimethyl)silyl]oxybut-2-enyl]propanedioate is C=C/C=C/C(C/C=C/CO[Si](C)(C)C(C)(C)C)(C(=O)OC)C(=O)OC.
What is the InChIKey of dimethyl 2-[(1E)-buta-1,3-dienyl]-2-[(E)-4-[tert-butyl(dimethyl)silyl]oxybut-2-enyl]propanedioate?
The InChIKey is SSZOHUCYUZLAEP-JASOSIDASA-N. The full InChI is InChI=1S/C19H32O5Si/c1-9-10-13-19(16(20)22-5,17(21)23-6)14-11-12-15-24-25(7,8)18(2,3)4/h9-13H,1,14-15H2,2-8H3/b12-11+,13-10+.
What are the key properties of dimethyl 2-[(1E)-buta-1,3-dienyl]-2-[(E)-4-[tert-butyl(dimethyl)silyl]oxybut-2-enyl]propanedioate?
dimethyl 2-[(1E)-buta-1,3-dienyl]-2-[(E)-4-[tert-butyl(dimethyl)silyl]oxybut-2-enyl]propanedioate has a molecular weight of 368.55 g/mol, XLogP of 4.03, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-[(1E)-buta-1,3-dienyl]-2-[(E)-4-[tert-butyl(dimethyl)silyl]oxybut-2-enyl]propanedioate is sourced from PubChem (CID 11326122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).