C21H31N3O3 — CID 11326271
1-(2-amino-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-3-yl)azepan-2-one (PubChem CID 11326271) has the molecular formula C21H31N3O3 and a molecular weight of 373.50 g/mol. Its IUPAC name is 1-(2-amino-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-3-yl)azepan-2-one.
| Compound Name | 1-(2-amino-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-3-yl)azepan-2-one |
|---|---|
| PubChem CID | 11326271 |
| Molecular Formula | C21H31N3O3 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | 1-(2-amino-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-3-yl)azepan-2-one |
| SMILES | COc1cc2c(cc1OC)C1CC(N)C(N3CCCCCC3=O)CN1CC2 |
| InChI | InChI=1S/C21H31N3O3/c1-26-19-10-14-7-9-23-13-18(24-8-5-3-4-6-21(24)25)16(22)12-17(23)15(14)11-20(19)27-2/h10-11,16-18H,3-9,12-13,22H2,1-2H3 |
| InChIKey | HNCSYKUUKHXRCJ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 68.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |