About 8-(2,5-dichlorophenyl)sulfanyl-9-pent-4-ynylpurin-6-amine
8-(2,5-dichlorophenyl)sulfanyl-9-pent-4-ynylpurin-6-amine (PubChem CID 11326407) has the molecular formula C16H13Cl2N5S
and a molecular weight of 378.29 g/mol. Its IUPAC name is 8-(2,5-dichlorophenyl)sulfanyl-9-pent-4-ynylpurin-6-amine.
Molecular Properties
| Compound Name | 8-(2,5-dichlorophenyl)sulfanyl-9-pent-4-ynylpurin-6-amine |
| PubChem CID | 11326407 |
| Molecular Formula | C16H13Cl2N5S |
| Molecular Weight | 378.29 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | 8-(2,5-dichlorophenyl)sulfanyl-9-pent-4-ynylpurin-6-amine |
| SMILES | C#CCCCn1c(Sc2cc(Cl)ccc2Cl)nc2c(N)ncnc21 |
| InChI | InChI=1S/C16H13Cl2N5S/c1-2-3-4-7-23-15-13(14(19)20-9-21-15)22-16(23)24-12-8-10(17)5-6-11(12)18/h1,5-6,8-9H,3-4,7H2,(H2,19,20,21) |
| InChIKey | QGGASVLFFHJUTI-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.29 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-(2,5-dichlorophenyl)sulfanyl-9-pent-4-ynylpurin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(2,5-dichlorophenyl)sulfanyl-9-pent-4-ynylpurin-6-amine?
The IUPAC name of 8-(2,5-dichlorophenyl)sulfanyl-9-pent-4-ynylpurin-6-amine (CID 11326407) is 8-(2,5-dichlorophenyl)sulfanyl-9-pent-4-ynylpurin-6-amine.
What is the SMILES notation for 8-(2,5-dichlorophenyl)sulfanyl-9-pent-4-ynylpurin-6-amine?
The canonical SMILES for 8-(2,5-dichlorophenyl)sulfanyl-9-pent-4-ynylpurin-6-amine is C#CCCCn1c(Sc2cc(Cl)ccc2Cl)nc2c(N)ncnc21.
What is the InChIKey of 8-(2,5-dichlorophenyl)sulfanyl-9-pent-4-ynylpurin-6-amine?
The InChIKey is QGGASVLFFHJUTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13Cl2N5S/c1-2-3-4-7-23-15-13(14(19)20-9-21-15)22-16(23)24-12-8-10(17)5-6-11(12)18/h1,5-6,8-9H,3-4,7H2,(H2,19,20,21).
What are the key properties of 8-(2,5-dichlorophenyl)sulfanyl-9-pent-4-ynylpurin-6-amine?
8-(2,5-dichlorophenyl)sulfanyl-9-pent-4-ynylpurin-6-amine has a molecular weight of 378.29 g/mol, XLogP of 4.28, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(2,5-dichlorophenyl)sulfanyl-9-pent-4-ynylpurin-6-amine is sourced from PubChem (CID 11326407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).