C20H18ClN5O — CID 11326461
3-[5-[1-[(6-chloro-2-pyridinyl)methyl]piperidin-2-yl]-1,2,4-oxadiazol-3-yl]benzonitrile (PubChem CID 11326461) has the molecular formula C20H18ClN5O and a molecular weight of 379.85 g/mol. Its IUPAC name is 3-[5-[1-[(6-chloro-2-pyridinyl)methyl]piperidin-2-yl]-1,2,4-oxadiazol-3-yl]benzonitrile.
| Compound Name | 3-[5-[1-[(6-chloro-2-pyridinyl)methyl]piperidin-2-yl]-1,2,4-oxadiazol-3-yl]benzonitrile |
|---|---|
| PubChem CID | 11326461 |
| Molecular Formula | C20H18ClN5O |
| Molecular Weight | 379.85 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 3-[5-[1-[(6-chloro-2-pyridinyl)methyl]piperidin-2-yl]-1,2,4-oxadiazol-3-yl]benzonitrile |
| SMILES | N#Cc1cccc(-c2noc(C3CCCCN3Cc3cccc(Cl)n3)n2)c1 |
| InChI | InChI=1S/C20H18ClN5O/c21-18-9-4-7-16(23-18)13-26-10-2-1-8-17(26)20-24-19(25-27-20)15-6-3-5-14(11-15)12-22/h3-7,9,11,17H,1-2,8,10,13H2 |
| InChIKey | XQOFITHHFDAAIZ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 78.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.85 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|