C12H17ClN4O — CID 113265016
5-chloro-N-methyl-N-[(1-methylpyrrolidin-3-yl)methyl]pyrazine-2-carboxamide (PubChem CID 113265016) has the molecular formula C12H17ClN4O and a molecular weight of 268.75 g/mol. Its IUPAC name is 5-chloro-N-methyl-N-[(1-methylpyrrolidin-3-yl)methyl]pyrazine-2-carboxamide.
| Compound Name | 5-chloro-N-methyl-N-[(1-methylpyrrolidin-3-yl)methyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 113265016 |
| Molecular Formula | C12H17ClN4O |
| Molecular Weight | 268.75 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 5-chloro-N-methyl-N-[(1-methylpyrrolidin-3-yl)methyl]pyrazine-2-carboxamide |
| SMILES | CN1CCC(CN(C)C(=O)c2cnc(Cl)cn2)C1 |
| InChI | InChI=1S/C12H17ClN4O/c1-16-4-3-9(7-16)8-17(2)12(18)10-5-15-11(13)6-14-10/h5-6,9H,3-4,7-8H2,1-2H3 |
| InChIKey | UJORJNZIQPQXFM-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.75 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |