C22H22O4S — CID 11326538
2-(4-methylsulfonylphenyl)-3-phenyl-1-oxaspiro[4.5]dec-2-en-4-one (PubChem CID 11326538) has the molecular formula C22H22O4S and a molecular weight of 382.48 g/mol. Its IUPAC name is 2-(4-methylsulfonylphenyl)-3-phenyl-1-oxaspiro[4.5]dec-2-en-4-one.
| Compound Name | 2-(4-methylsulfonylphenyl)-3-phenyl-1-oxaspiro[4.5]dec-2-en-4-one |
|---|---|
| PubChem CID | 11326538 |
| Molecular Formula | C22H22O4S |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 2-(4-methylsulfonylphenyl)-3-phenyl-1-oxaspiro[4.5]dec-2-en-4-one |
| SMILES | CS(=O)(=O)c1ccc(C2=C(c3ccccc3)C(=O)C3(CCCCC3)O2)cc1 |
| InChI | InChI=1S/C22H22O4S/c1-27(24,25)18-12-10-17(11-13-18)20-19(16-8-4-2-5-9-16)21(23)22(26-20)14-6-3-7-15-22/h2,4-5,8-13H,3,6-7,14-15H2,1H3 |
| InChIKey | CNFJWHFRNQKWQV-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|