C13H16FIN2O — CID 113265487
[2-(aminomethyl)piperidin-1-yl]-(4-fluoro-2-iodophenyl)methanone (PubChem CID 113265487) has the molecular formula C13H16FIN2O and a molecular weight of 362.19 g/mol. Its IUPAC name is [2-(aminomethyl)piperidin-1-yl]-(4-fluoro-2-iodophenyl)methanone.
| Compound Name | [2-(aminomethyl)piperidin-1-yl]-(4-fluoro-2-iodophenyl)methanone |
|---|---|
| PubChem CID | 113265487 |
| Molecular Formula | C13H16FIN2O |
| Molecular Weight | 362.19 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | [2-(aminomethyl)piperidin-1-yl]-(4-fluoro-2-iodophenyl)methanone |
| SMILES | NCC1CCCCN1C(=O)c1ccc(F)cc1I |
| InChI | InChI=1S/C13H16FIN2O/c14-9-4-5-11(12(15)7-9)13(18)17-6-2-1-3-10(17)8-16/h4-5,7,10H,1-3,6,8,16H2 |
| InChIKey | OFEGKSOFNBZLIW-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.19 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|