About 4-(3-acetylphenyl)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-one
4-(3-acetylphenyl)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-one (PubChem CID 11326591) has the molecular formula C21H20O5S
and a molecular weight of 384.45 g/mol. Its IUPAC name is 4-(3-acetylphenyl)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-one.
Molecular Properties
| Compound Name | 4-(3-acetylphenyl)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-one |
| PubChem CID | 11326591 |
| Molecular Formula | C21H20O5S |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 4-(3-acetylphenyl)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-one |
| SMILES | CC(=O)c1cccc(C2=C(c3ccc(S(C)(=O)=O)cc3)OC(C)(C)C2=O)c1 |
| InChI | InChI=1S/C21H20O5S/c1-13(22)15-6-5-7-16(12-15)18-19(26-21(2,3)20(18)23)14-8-10-17(11-9-14)27(4,24)25/h5-12H,1-4H3 |
| InChIKey | UZMDRBXCKGDLMV-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-acetylphenyl)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-acetylphenyl)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-one?
The IUPAC name of 4-(3-acetylphenyl)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-one (CID 11326591) is 4-(3-acetylphenyl)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-one.
What is the SMILES notation for 4-(3-acetylphenyl)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-one?
The canonical SMILES for 4-(3-acetylphenyl)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-one is CC(=O)c1cccc(C2=C(c3ccc(S(C)(=O)=O)cc3)OC(C)(C)C2=O)c1.
What is the InChIKey of 4-(3-acetylphenyl)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-one?
The InChIKey is UZMDRBXCKGDLMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20O5S/c1-13(22)15-6-5-7-16(12-15)18-19(26-21(2,3)20(18)23)14-8-10-17(11-9-14)27(4,24)25/h5-12H,1-4H3.
What are the key properties of 4-(3-acetylphenyl)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-one?
4-(3-acetylphenyl)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-one has a molecular weight of 384.45 g/mol, XLogP of 3.54, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-acetylphenyl)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-one is sourced from PubChem (CID 11326591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).