About (1,1-dioxo-1,4-thiazepan-4-yl)-morpholin-2-ylmethanone
(1,1-dioxo-1,4-thiazepan-4-yl)-morpholin-2-ylmethanone (PubChem CID 113266787) has the molecular formula C10H18N2O4S
and a molecular weight of 262.33 g/mol. Its IUPAC name is (1,1-dioxo-1,4-thiazepan-4-yl)-morpholin-2-ylmethanone.
Molecular Properties
| Compound Name | (1,1-dioxo-1,4-thiazepan-4-yl)-morpholin-2-ylmethanone |
| PubChem CID | 113266787 |
| Molecular Formula | C10H18N2O4S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | (1,1-dioxo-1,4-thiazepan-4-yl)-morpholin-2-ylmethanone |
| SMILES | O=C(C1CNCCO1)N1CCCS(=O)(=O)CC1 |
| InChI | InChI=1S/C10H18N2O4S/c13-10(9-8-11-2-5-16-9)12-3-1-6-17(14,15)7-4-12/h9,11H,1-8H2 |
| InChIKey | MAUZEIGRWVJIDC-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1,1-dioxo-1,4-thiazepan-4-yl)-morpholin-2-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,1-dioxo-1,4-thiazepan-4-yl)-morpholin-2-ylmethanone?
The IUPAC name of (1,1-dioxo-1,4-thiazepan-4-yl)-morpholin-2-ylmethanone (CID 113266787) is (1,1-dioxo-1,4-thiazepan-4-yl)-morpholin-2-ylmethanone.
What is the SMILES notation for (1,1-dioxo-1,4-thiazepan-4-yl)-morpholin-2-ylmethanone?
The canonical SMILES for (1,1-dioxo-1,4-thiazepan-4-yl)-morpholin-2-ylmethanone is O=C(C1CNCCO1)N1CCCS(=O)(=O)CC1.
What is the InChIKey of (1,1-dioxo-1,4-thiazepan-4-yl)-morpholin-2-ylmethanone?
The InChIKey is MAUZEIGRWVJIDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O4S/c13-10(9-8-11-2-5-16-9)12-3-1-6-17(14,15)7-4-12/h9,11H,1-8H2.
What are the key properties of (1,1-dioxo-1,4-thiazepan-4-yl)-morpholin-2-ylmethanone?
(1,1-dioxo-1,4-thiazepan-4-yl)-morpholin-2-ylmethanone has a molecular weight of 262.33 g/mol, XLogP of -1.38, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1,1-dioxo-1,4-thiazepan-4-yl)-morpholin-2-ylmethanone is sourced from PubChem (CID 113266787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).