C10H18N2O4S — CID 113266787
(1,1-dioxo-1,4-thiazepan-4-yl)-morpholin-2-ylmethanone (PubChem CID 113266787) has the molecular formula C10H18N2O4S and a molecular weight of 262.33 g/mol. Its IUPAC name is (1,1-dioxo-1,4-thiazepan-4-yl)-morpholin-2-ylmethanone.
| Compound Name | (1,1-dioxo-1,4-thiazepan-4-yl)-morpholin-2-ylmethanone |
|---|---|
| PubChem CID | 113266787 |
| Molecular Formula | C10H18N2O4S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | (1,1-dioxo-1,4-thiazepan-4-yl)-morpholin-2-ylmethanone |
| SMILES | O=C(C1CNCCO1)N1CCCS(=O)(=O)CC1 |
| InChI | InChI=1S/C10H18N2O4S/c13-10(9-8-11-2-5-16-9)12-3-1-6-17(14,15)7-4-12/h9,11H,1-8H2 |
| InChIKey | MAUZEIGRWVJIDC-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |