C23H20N2O2S — CID 11326698
14-[3-(dimethylamino)propyl]-8-thia-14-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2,4,6,9,11,16(20),17-octaene-13,15-dione (PubChem CID 11326698) has the molecular formula C23H20N2O2S and a molecular weight of 388.49 g/mol. Its IUPAC name is 14-[3-(dimethylamino)propyl]-8-thia-14-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2,4,6,9,11,16(20),17-octaene-13,15-dione.
| Compound Name | 14-[3-(dimethylamino)propyl]-8-thia-14-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2,4,6,9,11,16(20),17-octaene-13,15-dione |
|---|---|
| PubChem CID | 11326698 |
| Molecular Formula | C23H20N2O2S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 14-[3-(dimethylamino)propyl]-8-thia-14-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2,4,6,9,11,16(20),17-octaene-13,15-dione |
| SMILES | CN(C)CCCn1c(=O)c2ccc3sc4ccccc4c4ccc(c1=O)c2c34 |
| InChI | InChI=1S/C23H20N2O2S/c1-24(2)12-5-13-25-22(26)16-9-8-15-14-6-3-4-7-18(14)28-19-11-10-17(23(25)27)20(16)21(15)19/h3-4,6-11H,5,12-13H2,1-2H3 |
| InChIKey | OZXJJNODTJEUTM-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|