C14H20N2OS — CID 113267007
2-anilino-1-(2,2-dimethylthiomorpholin-4-yl)ethanone (PubChem CID 113267007) has the molecular formula C14H20N2OS and a molecular weight of 264.39 g/mol. Its IUPAC name is 2-anilino-1-(2,2-dimethylthiomorpholin-4-yl)ethanone.
| Compound Name | 2-anilino-1-(2,2-dimethylthiomorpholin-4-yl)ethanone |
|---|---|
| PubChem CID | 113267007 |
| Molecular Formula | C14H20N2OS |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 2-anilino-1-(2,2-dimethylthiomorpholin-4-yl)ethanone |
| SMILES | CC1(C)CN(C(=O)CNc2ccccc2)CCS1 |
| InChI | InChI=1S/C14H20N2OS/c1-14(2)11-16(8-9-18-14)13(17)10-15-12-6-4-3-5-7-12/h3-7,15H,8-11H2,1-2H3 |
| InChIKey | PYAWDFKGUNSTGI-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |