C22H30O4S — CID 11326742
(2R,6R)-2-[(1E,3Z,5R)-7-(benzenesulfonyl)-3-ethyl-5-methylhepta-1,3-dienyl]-6-methoxy-3,6-dihydro-2H-pyran (PubChem CID 11326742) has the molecular formula C22H30O4S and a molecular weight of 390.55 g/mol. Its IUPAC name is (2R,6R)-2-[(1E,3Z,5R)-7-(benzenesulfonyl)-3-ethyl-5-methylhepta-1,3-dienyl]-6-methoxy-3,6-dihydro-2H-pyran.
| Compound Name | (2R,6R)-2-[(1E,3Z,5R)-7-(benzenesulfonyl)-3-ethyl-5-methylhepta-1,3-dienyl]-6-methoxy-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 11326742 |
| Molecular Formula | C22H30O4S |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | (2R,6R)-2-[(1E,3Z,5R)-7-(benzenesulfonyl)-3-ethyl-5-methylhepta-1,3-dienyl]-6-methoxy-3,6-dihydro-2H-pyran |
| SMILES | CCC(=C/[C@H](C)CCS(=O)(=O)c1ccccc1)/C=C/[C@H]1CC=C[C@H](OC)O1 |
| InChI | InChI=1S/C22H30O4S/c1-4-19(13-14-20-9-8-12-22(25-3)26-20)17-18(2)15-16-27(23,24)21-10-6-5-7-11-21/h5-8,10-14,17-18,20,22H,4,9,15-16H2,1-3H3/b14-13+,19-17-/t18-,20-,22-/m1/s1 |
| InChIKey | HGAAZATWMGJHDB-CGUNCFFNSA-N |
| XLogP | 4.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|