C21H24ClFN2O2 — CID 11326750
(6R,8S)-6-[[(3R,4R)-4-(2-chloro-4-fluorophenyl)-3-hydroxypiperidin-1-yl]methyl]-5,6,7,8-tetrahydroquinolin-8-ol (PubChem CID 11326750) has the molecular formula C21H24ClFN2O2 and a molecular weight of 390.89 g/mol. Its IUPAC name is (6R,8S)-6-[[(3R,4R)-4-(2-chloro-4-fluorophenyl)-3-hydroxypiperidin-1-yl]methyl]-5,6,7,8-tetrahydroquinolin-8-ol.
| Compound Name | (6R,8S)-6-[[(3R,4R)-4-(2-chloro-4-fluorophenyl)-3-hydroxypiperidin-1-yl]methyl]-5,6,7,8-tetrahydroquinolin-8-ol |
|---|---|
| PubChem CID | 11326750 |
| Molecular Formula | C21H24ClFN2O2 |
| Molecular Weight | 390.89 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | (6R,8S)-6-[[(3R,4R)-4-(2-chloro-4-fluorophenyl)-3-hydroxypiperidin-1-yl]methyl]-5,6,7,8-tetrahydroquinolin-8-ol |
| SMILES | O[C@H]1C[C@H](CN2CC[C@H](c3ccc(F)cc3Cl)[C@@H](O)C2)Cc2cccnc21 |
| InChI | InChI=1S/C21H24ClFN2O2/c22-18-10-15(23)3-4-16(18)17-5-7-25(12-20(17)27)11-13-8-14-2-1-6-24-21(14)19(26)9-13/h1-4,6,10,13,17,19-20,26-27H,5,7-9,11-12H2/t13-,17-,19+,20+/m1/s1 |
| InChIKey | JWRFFRGIXWVGLV-PTLICHBZSA-N |
| XLogP | 3.32 |
| TPSA | 56.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.89 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |