C19H21N9O — CID 11326769
2-(furan-2-yl)-5-[4-[(2-methyl-3-pyridinyl)methyl]piperazin-1-yl]-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine (PubChem CID 11326769) has the molecular formula C19H21N9O and a molecular weight of 391.44 g/mol. Its IUPAC name is 2-(furan-2-yl)-5-[4-[(2-methyl-3-pyridinyl)methyl]piperazin-1-yl]-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine.
| Compound Name | 2-(furan-2-yl)-5-[4-[(2-methyl-3-pyridinyl)methyl]piperazin-1-yl]-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine |
|---|---|
| PubChem CID | 11326769 |
| Molecular Formula | C19H21N9O |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 2-(furan-2-yl)-5-[4-[(2-methyl-3-pyridinyl)methyl]piperazin-1-yl]-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine |
| SMILES | Cc1ncccc1CN1CCN(c2nc(N)n3nc(-c4ccco4)nc3n2)CC1 |
| InChI | InChI=1S/C19H21N9O/c1-13-14(4-2-6-21-13)12-26-7-9-27(10-8-26)18-23-17(20)28-19(24-18)22-16(25-28)15-5-3-11-29-15/h2-6,11H,7-10,12H2,1H3,(H2,20,22,23,24,25) |
| InChIKey | OKRIENOGRUNHAX-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 114.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |