C14H14NO10P — CID 11326827
(1R,13R,14S,18R,19S,20R)-9,16,19,20-tetrahydroxy-16-oxo-5,7,15,17-tetraoxa-12-aza-16λ5-phosphapentacyclo[11.7.0.02,10.04,8.014,18]icosa-2,4(8),9-trien-11-one (PubChem CID 11326827) has the molecular formula C14H14NO10P and a molecular weight of 387.24 g/mol. Its IUPAC name is (1R,13R,14S,18R,19S,20R)-9,16,19,20-tetrahydroxy-16-oxo-5,7,15,17-tetraoxa-12-aza-16λ5-phosphapentacyclo[11.7.0.02,10.04,8.014,18]icosa-2,4(8),9-trien-11-one.
| Compound Name | (1R,13R,14S,18R,19S,20R)-9,16,19,20-tetrahydroxy-16-oxo-5,7,15,17-tetraoxa-12-aza-16λ5-phosphapentacyclo[11.7.0.02,10.04,8.014,18]icosa-2,4(8),9-trien-11-one |
|---|---|
| PubChem CID | 11326827 |
| Molecular Formula | C14H14NO10P |
| Molecular Weight | 387.24 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | (1R,13R,14S,18R,19S,20R)-9,16,19,20-tetrahydroxy-16-oxo-5,7,15,17-tetraoxa-12-aza-16λ5-phosphapentacyclo[11.7.0.02,10.04,8.014,18]icosa-2,4(8),9-trien-11-one |
| SMILES | O=C1N[C@H]2[C@@H]3OP(=O)(O)O[C@@H]3[C@@H](O)[C@H](O)[C@@H]2c2cc3c(c(O)c21)OCO3 |
| InChI | InChI=1S/C14H14NO10P/c16-8-5-3-1-4-11(23-2-22-4)9(17)6(3)14(19)15-7(5)12-13(10(8)18)25-26(20,21)24-12/h1,5,7-8,10,12-13,16-18H,2H2,(H,15,19)(H,20,21)/t5-,7-,8-,10+,12+,13-/m1/s1 |
| InChIKey | SKVQVQWQRYNHGS-UAGGCRPCSA-N |
| XLogP | -1.06 |
| TPSA | 164.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.24 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|