C14H11BrN2OS — CID 113268388
N-(2-bromo-3-pyridinyl)-2,3-dihydro-1-benzothiophene-3-carboxamide (PubChem CID 113268388) has the molecular formula C14H11BrN2OS and a molecular weight of 335.23 g/mol. Its IUPAC name is N-(2-bromo-3-pyridinyl)-2,3-dihydro-1-benzothiophene-3-carboxamide.
| Compound Name | N-(2-bromo-3-pyridinyl)-2,3-dihydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 113268388 |
| Molecular Formula | C14H11BrN2OS |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 333.98 |
| IUPAC Name | N-(2-bromo-3-pyridinyl)-2,3-dihydro-1-benzothiophene-3-carboxamide |
| SMILES | O=C(Nc1cccnc1Br)C1CSc2ccccc21 |
| InChI | InChI=1S/C14H11BrN2OS/c15-13-11(5-3-7-16-13)17-14(18)10-8-19-12-6-2-1-4-9(10)12/h1-7,10H,8H2,(H,17,18) |
| InChIKey | MVGMGEWAEDTZLN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|