C22H37NO5 — CID 11326902
1-O-tert-butyl 5-O-ethyl (2S,3R)-2-[[(1R,2R,5R)-2-hydroxy-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene]amino]-3-methylpentanedioate (PubChem CID 11326902) has the molecular formula C22H37NO5 and a molecular weight of 395.54 g/mol. Its IUPAC name is 1-O-tert-butyl 5-O-ethyl (2S,3R)-2-[[(1R,2R,5R)-2-hydroxy-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene]amino]-3-methylpentanedioate.
| Compound Name | 1-O-tert-butyl 5-O-ethyl (2S,3R)-2-[[(1R,2R,5R)-2-hydroxy-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene]amino]-3-methylpentanedioate |
|---|---|
| PubChem CID | 11326902 |
| Molecular Formula | C22H37NO5 |
| Molecular Weight | 395.54 g/mol |
| Exact Mass | 395.27 |
| IUPAC Name | 1-O-tert-butyl 5-O-ethyl (2S,3R)-2-[[(1R,2R,5R)-2-hydroxy-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene]amino]-3-methylpentanedioate |
| SMILES | CCOC(=O)C[C@@H](C)[C@H](/N=C1\C[C@H]2C[C@H](C2(C)C)[C@@]1(C)O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H37NO5/c1-9-27-17(24)10-13(2)18(19(25)28-20(3,4)5)23-16-12-14-11-15(21(14,6)7)22(16,8)26/h13-15,18,26H,9-12H2,1-8H3/b23-16+/t13-,14-,15-,18+,22-/m1/s1 |
| InChIKey | ICJLXVJTGXJQBC-ZTFNDAHHSA-N |
| XLogP | 3.54 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.54 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|